missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Méthyl 3-trifluorométhylbenzoylacétate, 95 %, Thermo Scientific™
83.30€ - 258.00€
Identifiants chimiques
| CAS | 93618-66-7 |
|---|---|
| Formule moléculaire | C11H9F3O3 |
| Poids moléculaire (g/mol) | 246.19 |
| Numéro MDL | MFCD00216522 |
| Clé InChI | RPRMYRPHNDGZOY-UHFFFAOYSA-N |
| Synonyme | methyl 3-oxo-3-3-trifluoromethyl phenyl propanoate, methyl 3-trifluoromethyl benzoylacetate, methyl 3-trifluoromethyl benzoyl acetate, 3-3-trifluoromethylphenyl-3-oxo-propionic acid methyl ester, 3-oxo-3-3-trifluoromethyl-phenyl-propionic acid methyl ester, pubchem2695, methyl 3-trifluoromethylbenzoylacetate, methyl 3-oxo-3-3-trifluoromethylphenyl propanoate, 3-oxo-3-3-trifluoromethylphenyl propionic acid methyl ester |
| CID PubChem | 735880 |
| Nom IUPAC | méthyl3-oxo-3-[3-(trifluorométhyl)phényl]propanoate |
| SMILES | COC(=O)CC(=O)C1=CC=CC(=C1)C(F)(F)F |
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|
10341551
|
Thermo Scientific Acros
425450025 |
2.5 g | Flacon en verre |
83.30€
2.50g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
|
10731715
|
Thermo Scientific Acros
425450100 |
10 g | Flacon en verre |
258.00€
10g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
Description
Identifiants chimiques
| 93618-66-7 | |
| 246.19 | |
| RPRMYRPHNDGZOY-UHFFFAOYSA-N | |
| 735880 | |
| COC(=O)CC(=O)C1=CC=CC(=C1)C(F)(F)F |
| C11H9F3O3 | |
| MFCD00216522 | |
| methyl 3-oxo-3-3-trifluoromethyl phenyl propanoate, methyl 3-trifluoromethyl benzoylacetate, methyl 3-trifluoromethyl benzoyl acetate, 3-3-trifluoromethylphenyl-3-oxo-propionic acid methyl ester, 3-oxo-3-3-trifluoromethyl-phenyl-propionic acid methyl ester, pubchem2695, methyl 3-trifluoromethylbenzoylacetate, methyl 3-oxo-3-3-trifluoromethylphenyl propanoate, 3-oxo-3-3-trifluoromethylphenyl propionic acid methyl ester | |
| méthyl3-oxo-3-[3-(trifluorométhyl)phényl]propanoate |
Spécification
| Methyl 3-trifluoromethylbenzoylacetate | |
| Jaune | |
| >200°C | |
| 94% min. (HPLC) | |
| 1.4864 to 1.4884 | |
| methyl 3-oxo-3-3-trifluoromethyl phenyl propanoate, methyl 3-trifluoromethyl benzoylacetate, methyl 3-trifluoromethyl benzoyl acetate, 3-3-trifluoromethylphenyl-3-oxo-propionic acid methyl ester, 3-oxo-3-3-trifluoromethyl-phenyl-propionic acid methyl ester, pubchem2695, methyl 3-trifluoromethylbenzoylacetate, methyl 3-oxo-3-3-trifluoromethylphenyl propanoate, 3-oxo-3-3-trifluoromethylphenyl propionic acid methyl ester | |
| RPRMYRPHNDGZOY-UHFFFAOYSA-N | |
| méthyl3-oxo-3-[3-(trifluorométhyl)phényl]propanoate | |
| 735880 | |
| 95% |
| 93618-66-7 | |
| 94°C to 96°C (0.2 mmHg) | |
| Authentique | |
| C11H9F3O3 | |
| MFCD00216522 | |
| Solubility in water: neglegible in water | |
| COC(=O)CC(=O)C1=CC=CC(=C1)C(F)(F)F | |
| 246.19 | |
| 246.18 | |
| Liquide |
RUO – Research Use Only