missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Sel de sodium HEPES, 99+ %, pour la biologie moléculaire, sans DNAse, sans RNAse et sans protéase, avec les composés organiques
130.65€ - 488.43€
Identifiants chimiques
| CAS | 75277-39-3 |
|---|---|
| Formule moléculaire | C8H17N2NaO4S |
| Poids moléculaire (g/mol) | 260.28 |
| Numéro MDL | MFCD00036463 |
| Clé InChI | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| Synonyme | 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt |
| CID PubChem | 2724248 |
| ChEBI | CHEBI:46758 |
| Nom IUPAC | Sodium ; 2-[4-(2-hydroxyéthyl)pipérazine-1-yl]éthanesulfonate |
| SMILES | [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|
10328103
|
Thermo Scientific Chemicals
327261000 |
100 g | Flacon en plastique |
130.65€
100g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
|
10653332
|
Thermo Scientific Chemicals
327265000 |
500 g | Flacon en plastique |
488.43€
500g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Tampon biologiqueIdentifiants chimiques
| 75277-39-3 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2724248 | |
| Sodium ; 2-[4-(2-hydroxyéthyl)pipérazine-1-yl]éthanesulfonate |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt | |
| CHEBI:46758 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
Spécification
| (0.1 M in H2O), (0.1 M in H2O) at 0nm, 0.02 max. at 280nm, 0.04 max. at 260nm | |
| (0.1M in H2O) | |
| 75277-39-3 | |
| Blanc | |
| Poudre cristalline | |
| Authentique | |
| MFCD00036463 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| Sodium ; 2-[4-(2-hydroxyéthyl)pipérazine-1-yl]éthanesulfonate | |
| 2724248 | |
| 260.27 | |
| Biologie moléculaire |
| HEPES sodium salt | |
| 99+% | |
| 248.0°C | |
| 5.0 to 15.0 (1% soln.) | |
| 99+% | |
| C8H17N2NaO4S | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:46758 | |
| ≥99% |
RUO – Research Use Only