missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ester méthylique CBZ-L-sérine, 95 %, Thermo Scientific Chemicals
18.69€ - 117.00€
Identifiants chimiques
| CAS | 1676-81-9 |
|---|---|
| Formule moléculaire | C12H15NO5 |
| Poids moléculaire (g/mol) | 253.25 |
| Numéro MDL | MFCD00077039 |
| Clé InChI | CINAUOAOVQPWIB-UHFFFAOYNA-N |
| Synonyme | z-ser-ome, n-cbz-l-serine methyl ester, cbz-ser-ome, n-carbobenzoxy-l-serine methyl ester, z-l-serine methyl ester, cbz-l-serine methyl ester, n-z-l-serine methyl ester, s-methyl 2-benzyloxy carbonyl amino-3-hydroxypropanoate, n-carbobenzyloxy-l-serine methyl ester, d-n-cbz-serine methyl ester |
| CID PubChem | 6999535 |
| Nom IUPAC | methyl 2-{[(benzyloxy)carbonyl]amino}-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)OCC1=CC=CC=C1 |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 1676-81-9 | |
| 253.25 | |
| CINAUOAOVQPWIB-UHFFFAOYNA-N | |
| 6999535 | |
| COC(=O)C(CO)NC(=O)OCC1=CC=CC=C1 |
| C12H15NO5 | |
| MFCD00077039 | |
| z-ser-ome, n-cbz-l-serine methyl ester, cbz-ser-ome, n-carbobenzoxy-l-serine methyl ester, z-l-serine methyl ester, cbz-l-serine methyl ester, n-z-l-serine methyl ester, s-methyl 2-benzyloxy carbonyl amino-3-hydroxypropanoate, n-carbobenzyloxy-l-serine methyl ester, d-n-cbz-serine methyl ester | |
| methyl 2-{[(benzyloxy)carbonyl]amino}-3-hydroxypropanoate |
Spécification
| CBZ-L-Serine methyl ester | |
| Jaune | |
| 113°C | |
| 94% min. (HPLC) | |
| C12H15NO5 | |
| -13.5 | |
| CINAUOAOVQPWIB-UHFFFAOYNA-N | |
| methyl 2-{[(benzyloxy)carbonyl]amino}-3-hydroxypropanoate | |
| 6999535 | |
| 95% |
| 1676-81-9 | |
| 170°C (0.1 mmHg) | |
| Authentic | |
| Bouteille en verre | |
| MFCD00077039 | |
| z-ser-ome, n-cbz-l-serine methyl ester, cbz-ser-ome, n-carbobenzoxy-l-serine methyl ester, z-l-serine methyl ester, cbz-l-serine methyl ester, n-z-l-serine methyl ester, s-methyl 2-benzyloxy carbonyl amino-3-hydroxypropanoate, n-carbobenzyloxy-l-serine methyl ester, d-n-cbz-serine methyl ester | |
| COC(=O)C(CO)NC(=O)OCC1=CC=CC=C1 | |
| 253.25 | |
| 253.26 | |
| Liquide visqueux ou solide |
RUO – Research Use Only