missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals DL-thréonine, 99,5 %
41.51€ - 445.22€
Identifiants chimiques
| CAS | 80-68-2 |
|---|---|
| Formule moléculaire | C4H9NO3 |
| Poids moléculaire (g/mol) | 119.12 |
| Numéro MDL | MFCD00063722 |
| Clé InChI | AYFVYJQAPQTCCC-PWNYCUMCSA-N |
| Synonyme | dl-threonine, allo-dl-threonine, threonine, dl, dl-allothreonine, dl-2-amino-3-hydroxybutanoic acid, threonine l, h-dl-thr-oh, dl-allo-threonine, allothreonine, d, wln: qy1&yzvq-l |
| CID PubChem | 205 |
| ChEBI | CHEBI:38263 |
| SMILES | C[C@@H](O)[C@@H](N)C(O)=O |
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|
10347020
|
Thermo Scientific Chemicals
138940250 |
25 g | Flacon en verre |
41.51€
25g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
|
10193470
|
Thermo Scientific Chemicals
138941000 |
100 g | Flacon en verre |
123.62€
100g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
|
10560994
|
Thermo Scientific Chemicals
138945000 |
500 g | Flacon en verre |
445.22€
500g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 80-68-2 | |
| 119.12 | |
| AYFVYJQAPQTCCC-PWNYCUMCSA-N | |
| 205 | |
| C[C@@H](O)[C@@H](N)C(O)=O |
| C4H9NO3 | |
| MFCD00063722 | |
| dl-threonine, allo-dl-threonine, threonine, dl, dl-allothreonine, dl-2-amino-3-hydroxybutanoic acid, threonine l, h-dl-thr-oh, dl-allo-threonine, allothreonine, d, wln: qy1&yzvq-l | |
| CHEBI:38263 |
Spécification
| DL-Threonine | |
| 2ppm max. | |
| 200ppm max. | |
| Authentique | |
| 0.2% max. (1 g, 105°C, 3 hrs) | |
| C4H9NO3 | |
| MFCD00063722 | |
| 10, 9229 | |
| dl-threonine, allo-dl-threonine, threonine, dl, dl-allothreonine, dl-2-amino-3-hydroxybutanoic acid, threonine l, h-dl-thr-oh, dl-allo-threonine, allothreonine, d, wln: qy1&yzvq-l | |
| C[C@@H](O)[C@@H](N)C(O)=O | |
| 119.12 | |
| CHEBI:38263 | |
| 98.0 to 101.0% (on dried substance) |
| 80-68-2 | |
| Blanc | |
| 10ppm max. | |
| 99.5% | |
| (TLC) Passes Test | |
| CH3CH(OH)CH(NH2)CO2H | |
| 04, 514 | |
| 0.1% max. | |
| AYFVYJQAPQTCCC-PWNYCUMCSA-N | |
| Acide (2R,3R)-2-amino-3-hydroxybutanoïque | |
| 205 | |
| 119.12 | |
| Poudre cristalline ou cristaux |
Sécurité et traitement
Identifiant produit
- DL-Threonine
RUO – Research Use Only
Vous avez repéré une opportunité d'amélioration ?Partager une correction de contenu
Correction du contenu d'un produit
Veuillez fournir vos retours sur le contenu du produit en remplissant le formulaire ci-dessous.
Nom du produit