missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Solution de dichromate de potassium 0,0167M (0,1N), solution étalon traçable à NIST prête à l’emploi pour analyse volumétrique, Fisher Chemical
53.55€ - 72.65€
Identifiants chimiques
| CAS | 7778-50-9 |
|---|---|
| Formule moléculaire | Cr2K2O7 |
| Poids moléculaire (g/mol) | 294.182 |
| Numéro MDL | 11367 |
| Clé InChI | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonyme | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
| CID PubChem | 24502 |
| ChEBI | CHEBI:53444 |
| Nom IUPAC | dipotassium ; oxido-(oxido(dioxo)chromio)oxy-dioxochrome |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Description
Identifiants chimiques
| 7778-50-9 | |
| 294.182 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium ; oxido-(oxido(dioxo)chromio)oxy-dioxochrome |
| Cr2K2O7 | |
| 11367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Spécification
| 7778-50-9 | |
| Liquide | |
| 11367 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium ; oxido-(oxido(dioxo)chromio)oxy-dioxochrome | |
| 24502 | |
| 294.19g/mol |
| Orange | |
| Cr2K2O7 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Flacon en verre ambré |