missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nile Red 99 %
131.00€ - 842.00€
Identifiants chimiques
| CAS | 7385-67-3 |
|---|---|
| Formule moléculaire | C20H18N2O2 |
| Poids moléculaire (g/mol) | 318.38 |
| Numéro MDL | MFCD00011639 |
| Clé InChI | VOFUROIFQGPCGE-UHFFFAOYSA-N |
| Synonyme | Nile blue A oxazone |
| CID PubChem | 65182 |
| ChEBI | CHEBI:52169 |
| SMILES | CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 |
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|
10464311
|
Thermo Scientific Chemicals
415711000 |
100 mg | Flacon en verre |
131.00€
100mg |
En stock
Connectez-vous pour voir le stock disponible |
||||
|
10658904
|
Thermo Scientific Chemicals
415710010 |
1 g | Flacon en verre |
842.00€
1g |
En stock
Connectez-vous pour voir le stock disponible |
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 7385-67-3 | |
| 318.38 | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| 65182 | |
| CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 |
| C20H18N2O2 | |
| MFCD00011639 | |
| Nile blue A oxazone | |
| CHEBI:52169 |
Spécification
| Nile Red | |
| 99% | |
| 98.5 | |
| 99% | |
| MFCD00011639 | |
| 15, 6628 | |
| Solubility in water: almost insoluble. Other solubilities: soluble in acetone, acetonitrile, chloroform, thf,, ethanol, dmso, cs2, benzene, nitrobenzene, pyridin, e, hexane, diethyl ether | |
| Authentique | |
| 8-(diethylamino)-12H-10-oxa-5-azatetraphen-12-one | |
| 65182 | |
| 318.38 | |
| Pures | |
| Complies | |
| Poudre |
| 203.0°C to 205.0°C | |
| 7385-67-3 | |
| 100.0 | |
| C20H18N2O2 | |
| 27, II, 468 | |
| Nile blue A oxazone | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 | |
| 318.38 | |
| CHEBI:52169 | |
| 99% | |
| 98.5% min. | |
| Rouge foncé à rouge |
Sécurité et traitement
missing translation for 'einecsNumber' : 230-966-0
missing translation for 'tsca' : TSCA
RUO – Research Use Only