missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals N-Acétyl-L-leucine, 99 %
37.50€ - 126.00€
Identifiants chimiques
| CAS | 1188-21-2 |
|---|---|
| Formule moléculaire | C8H15NO3 |
| Poids moléculaire (g/mol) | 173.21 |
| Numéro MDL | MFCD00065131 |
| Clé InChI | WXNXCEHXYPACJF-JLDDOWRYNA-N |
| Synonyme | n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin |
| CID PubChem | 70912 |
| ChEBI | CHEBI:17786 |
| Nom IUPAC | Acide(2S)-2-acétamido-4-méthylpentanoïque |
| SMILES | CC(C)C[C@H](NC(C)=O)C(O)=O |
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|
10235961
|
Thermo Scientific Chemicals
347010050 |
5 g | Flacon en verre |
37.50€
5g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
|
10377181
|
Thermo Scientific Chemicals
347010250 |
25 g | Flacon en verre |
126.00€
25g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 1188-21-2 | |
| 173.21 | |
| WXNXCEHXYPACJF-JLDDOWRYNA-N | |
| 70912 | |
| Acide(2S)-2-acétamido-4-méthylpentanoïque |
| C8H15NO3 | |
| MFCD00065131 | |
| n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin | |
| CHEBI:17786 | |
| CC(C)C[C@H](NC(C)=O)C(O)=O |
Spécification
| N-Acetyl-L-leucine | |
| 1188-21-2 | |
| 100.0 | |
| Blanc | |
| 99% | |
| (CH3)2CHCH2CH(NHCOCH3)COOH | |
| − 24.50 | |
| (5% in ethanol) Clear colorless | |
| CC(C)C[C@H](NC(C)=O)C(O)=O | |
| 173.21 | |
| CHEBI:17786 | |
| 99% |
| 99% | |
| 98.5 | |
| 190.0°C | |
| Authentique | |
| C8H15NO3 | |
| MFCD00065131 | |
| n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin | |
| WXNXCEHXYPACJF-JLDDOWRYNA-N | |
| Acide(2S)-2-acétamido-4-méthylpentanoïque | |
| 70912 | |
| 173.21 | |
| Poudre cristalline |
Sécurité et traitement
missing translation for 'einecsNumber' : 214-706-3
missing translation for 'tsca' : TSCA
Identifiant produit
- N-Acetyl-L-leucine
RUO – Research Use Only