missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Méthylsulfoxyde-d6, pour RMN, +99 % d’atomes D, Thermo Scientific Chemicals
203.01€ - 752.75€
Identifiants chimiques
| CAS | 2206-27-1 |
|---|---|
| Formule moléculaire | C2H6OS |
| Poids moléculaire (g/mol) | 84.17 |
| Numéro MDL | MFCD00002090 |
| Clé InChI | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Synonyme | dimethyl sulfoxide-d6, dmso-d6, dimethylsulfoxide-d6, deuterated dmso, methane-d3,sulfinylbis-9ci, methane-d3, sulfinylbis, hexadeuterodimethyl sulfoxide, methane-d3-, sulfinylbis, methanesulfinylmethyl hydrogen, dimethyl-d6 sulfoxide |
| CID PubChem | 75151 |
| Nom IUPAC | trideutério(trideutériométhylsulfinyl)méthane |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|
10337930
|
Thermo Scientific Acros
174890500 |
50 ml | Flacon en verre |
203.01€
50mL |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
|
10169552
|
Thermo Scientific Acros
174892500 |
250 ml | Flacon en verre |
752.75€
250mL |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Pour NMRIdentifiants chimiques
| 2206-27-1 | |
| 84.17 | |
| IAZDPXIOMUYVGZ-WFGJKAKNSA-N | |
| 75151 | |
| [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| C2H6OS | |
| MFCD00002090 | |
| dimethyl sulfoxide-d6, dmso-d6, dimethylsulfoxide-d6, deuterated dmso, methane-d3,sulfinylbis-9ci, methane-d3, sulfinylbis, hexadeuterodimethyl sulfoxide, methane-d3-, sulfinylbis, methanesulfinylmethyl hydrogen, dimethyl-d6 sulfoxide | |
| trideutério(trideutériométhylsulfinyl)méthane |
Spécification
| Methyl sulfoxide-d6 | |
| Incolore | |
| 99,0% min | |
| 1,19 | |
| 0,1 % max. (coulométrique) | |
| 20,2°C | |
| C2H6OS | |
| 01, IV, 1279 | |
| dimethyl sulfoxide-d6, dmso-d6, dimethylsulfoxide-d6, deuterated dmso, methane-d3,sulfinylbis-9ci, methane-d3, sulfinylbis, hexadeuterodimethyl sulfoxide, methane-d3-, sulfinylbis, methanesulfinylmethyl hydrogen, dimethyl-d6 sulfoxide | |
| [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] | |
| 84.17 | |
| 84.18 |
| Liquide | |
| 1,1900 g/ml | |
| 88°C | |
| 2,4 mPa.s (20°C) | |
| 2206-27-1 | |
| 190,0°C | |
| MFCD00002090 | |
| 13,124; 16,177 | |
| IAZDPXIOMUYVGZ-WFGJKAKNSA-N | |
| trideutério(trideutériométhylsulfinyl)méthane | |
| 75151 | |
| RMN |
Sécurité et traitement
Identifiant produit
- Methyl sulfoxide-d6
RUO – Research Use Only