missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals ADA, 99 %, pour la biochimie
26.40€ - 69.00€
Identifiants chimiques
| CAS | 26239-55-4 |
|---|---|
| Formule moléculaire | C6H10N2O5 |
| Poids moléculaire (g/mol) | 190.155 |
| Numéro MDL | MFCD00008031 |
| Clé InChI | QZTKDVCDBIDYMD-UHFFFAOYSA-N |
| Synonyme | N-(2-Acetamido)iminodiacetic acid, N-(Carbamoylmethyl)iminodiacetic acid |
| CID PubChem | 117765 |
| ChEBI | CHEBI:43960 |
| Nom IUPAC | Acide 2-[(2-amino-2-oxoéthyl)-(carboxyméthyl)amino]acétique |
| SMILES | C(C(=O)N)N(CC(=O)O)CC(=O)O |
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Conditionnement | Prix | Quantité et disponibilité | ||||
|
10145140
|
Thermo Scientific Chemicals
228010250 |
25 g | Flacon en verre |
26.40€
25g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
|
10321044
|
Thermo Scientific Chemicals
228011000 |
100 g | Flacon en verre |
69.00€
100g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | ||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Tampon biologiqueIdentifiants chimiques
| 26239-55-4 | |
| 190.155 | |
| QZTKDVCDBIDYMD-UHFFFAOYSA-N | |
| 117765 | |
| Acide 2-[(2-amino-2-oxoéthyl)-(carboxyméthyl)amino]acétique |
| C6H10N2O5 | |
| MFCD00008031 | |
| N-(2-Acetamido)iminodiacetic acid, N-(Carbamoylmethyl)iminodiacetic acid | |
| CHEBI:43960 | |
| C(C(=O)N)N(CC(=O)O)CC(=O)O |
Spécification
| (9% soln. in 1 M NaOH), (9% soln. in 1 M NaOH) at 0nm, 0.08 max. at 300nm | |
| (9% soln. in 1M NaOH) | |
| 26239-55-4 | |
| 98.5 | |
| Blanc | |
| 99% | |
| 0.5% max. (110°C, 5 hrs) | |
| H2NCOCH2N(CH2CO2H)2 | |
| 15, 135 | |
| Solubilité dans l’eau : soluble.Autres solubilités : soluble dans l’alcool, insoluble dans le benzène, le chloroforme | |
| C(C(=O)N)N(CC(=O)O)CC(=O)O | |
| 190.155 | |
| CHEBI:43960 | |
| 99% |
| ADA | |
| For biochemistry | |
| 219.0°C | |
| 100.0 | |
| Poudre cristalline fine | |
| Authentique | |
| C6H10N2O5 | |
| MFCD00008031 | |
| N-(2-Acetamido)iminodiacetic acid, N-(Carbamoylmethyl)iminodiacetic acid | |
| QZTKDVCDBIDYMD-UHFFFAOYSA-N | |
| Acide 2-[(2-amino-2-oxoéthyl)-(carboxyméthyl)amino]acétique | |
| 117765 | |
| 190.16 | |
| Biochimie |
RUO – Research Use Only