missing translation for 'onlineSavingsMsg'
Learn More
Learn More
7-iodoisatine, 97 %, Thermo Scientific™
153.00€ - 451.00€
Identifiants chimiques
| CAS | 20780-78-3 |
|---|---|
| Formule moléculaire | C8H4INO2 |
| Poids moléculaire (g/mol) | 273.029 |
| Numéro MDL | MFCD01248407 |
| Clé InChI | RLGIFVDILDEIHL-UHFFFAOYSA-N |
| Synonyme | 7-iodoindoline-2,3-dione, 7-iodoisatin, 7-iodo-isatin, 7-iodo-2,3-dihydro-1h-indole-2,3-dione, 7-iodo-indole-2,3-dione, pubchem20658, 7-iodoindole-2,3-dione, 7-iodo-2,3-indolinedione, 7-iodo indole-2,3-dione, 7-iodo indoline-2,3-dione |
| CID PubChem | 4043705 |
| Nom IUPAC | 7-iodo-1H-indole-2,3-dione |
| SMILES | C1=CC2=C(C(=C1)I)NC(=O)C2=O |
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identifiants chimiques
| 20780-78-3 | |
| 273.029 | |
| RLGIFVDILDEIHL-UHFFFAOYSA-N | |
| 4043705 | |
| C1=CC2=C(C(=C1)I)NC(=O)C2=O |
| C8H4INO2 | |
| MFCD01248407 | |
| 7-iodoindoline-2,3-dione, 7-iodoisatin, 7-iodo-isatin, 7-iodo-2,3-dihydro-1h-indole-2,3-dione, 7-iodo-indole-2,3-dione, pubchem20658, 7-iodoindole-2,3-dione, 7-iodo-2,3-indolinedione, 7-iodo indole-2,3-dione, 7-iodo indoline-2,3-dione | |
| 7-iodo-1H-indole-2,3-dione |
Spécification
| 7-Iodoisatin | |
| C8H4INO2 | |
| Light sensitive | |
| RLGIFVDILDEIHL-UHFFFAOYSA-N | |
| 7-iodo-1H-indole-2,3-dione | |
| 4043705 | |
| 97% |
| 20780-78-3 | |
| MFCD01248407 | |
| 7-iodoindoline-2,3-dione, 7-iodoisatin, 7-iodo-isatin, 7-iodo-2,3-dihydro-1h-indole-2,3-dione, 7-iodo-indole-2,3-dione, pubchem20658, 7-iodoindole-2,3-dione, 7-iodo-2,3-indolinedione, 7-iodo indole-2,3-dione, 7-iodo indoline-2,3-dione | |
| C1=CC2=C(C(=C1)I)NC(=O)C2=O | |
| 273.029 | |
| 273.03 |
Sécurité et traitement
missing translation for 'tsca' : No
Recommended Storage : Température ambiante