missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-(3-Chloro-4-méthylphénylcarbamoyl)acide benzèneboronique, 98 %, Thermo Scientific™
72.70€ - 232.00€
Identifiants chimiques
| CAS | 913835-37-7 |
|---|---|
| Formule moléculaire | C14H13BClNO3 |
| Poids moléculaire (g/mol) | 289.522 |
| Numéro MDL | MFCD09027211 |
| Clé InChI | IZMAVYDCXUROFV-UHFFFAOYSA-N |
| Synonyme | n-3-chloro-4-methylphenyl 4-boronobenzamide, 4-3-chloro-4-methylphenyl carbamoyl phenyl boronic acid, 4-3-chloro-4-methylphenyl carbamoyl benzeneboronic acid, 4-3-chloro-4-methylphenyl carbamoyl phenylboronic acid, 4-3-chloro-4-methylphenyl carbamoyl phenyl boronicacid, 4-3-chloro-4-methylphenyl carbamoyl-phenyl boronic acid, boronic acid,b-4-3-chloro-4-methylphenyl amino carbonyl phenyl |
| CID PubChem | 44119159 |
| Nom IUPAC | [4-[(3-chloro-4-méthylphényl)carbamoyl]phényl] acide boronique |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC(=C(C=C2)C)Cl)(O)O |
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identifiants chimiques
| 913835-37-7 | |
| 289.522 | |
| IZMAVYDCXUROFV-UHFFFAOYSA-N | |
| 44119159 | |
| B(C1=CC=C(C=C1)C(=O)NC2=CC(=C(C=C2)C)Cl)(O)O |
| C14H13BClNO3 | |
| MFCD09027211 | |
| n-3-chloro-4-methylphenyl 4-boronobenzamide, 4-3-chloro-4-methylphenyl carbamoyl phenyl boronic acid, 4-3-chloro-4-methylphenyl carbamoyl benzeneboronic acid, 4-3-chloro-4-methylphenyl carbamoyl phenylboronic acid, 4-3-chloro-4-methylphenyl carbamoyl phenyl boronicacid, 4-3-chloro-4-methylphenyl carbamoyl-phenyl boronic acid, boronic acid,b-4-3-chloro-4-methylphenyl amino carbonyl phenyl | |
| [4-[(3-chloro-4-méthylphényl)carbamoyl]phényl] acide boronique |
Spécification
| 4-(3-Chloro-4-methylphenylcarbamoyl)benzeneboronic acid | |
| 217°C to 219°C | |
| MFCD09027211 | |
| IZMAVYDCXUROFV-UHFFFAOYSA-N | |
| [4-[(3-chloro-4-méthylphényl)carbamoyl]phényl] acide boronique | |
| 44119159 | |
| 98% |
| 913835-37-7 | |
| C14H13BClNO3 | |
| n-3-chloro-4-methylphenyl 4-boronobenzamide, 4-3-chloro-4-methylphenyl carbamoyl phenyl boronic acid, 4-3-chloro-4-methylphenyl carbamoyl benzeneboronic acid, 4-3-chloro-4-methylphenyl carbamoyl phenylboronic acid, 4-3-chloro-4-methylphenyl carbamoyl phenyl boronicacid, 4-3-chloro-4-methylphenyl carbamoyl-phenyl boronic acid, boronic acid,b-4-3-chloro-4-methylphenyl amino carbonyl phenyl | |
| B(C1=CC=C(C=C1)C(=O)NC2=CC(=C(C=C2)C)Cl)(O)O | |
| 289.522 | |
| 289.53 |
Sécurité et traitement
Déclaration GHS H
H315-H319-H335
Provoque une irritation cutanée.
Provoque une grave irritation oculaire.
Peut irriter les voies respiratoires.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
missing translation for 'tsca' : Non
Recommended Storage : Température ambiante